A6188112
Nalpha-Benzoyl-L-arginine , 98.5% , 154-92-7
CAS NO.:154-92-7
Empirical Formula: C13H18N4O3
Molecular Weight: 278.31
MDL number: MFCD00001763
EINECS: 205-837-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB34.40 | In Stock |
|
| 10g | RMB60.00 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 50g | RMB215.20 | In Stock |
|
| 100G | RMB375.20 | In Stock |
|
| 500g | RMB1799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 281-286 °C |
| Boiling point: | 421.13°C (rough estimate) |
| Density | 1.1713 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.76±0.10(Predicted) |
| InChI | InChI=1S/C13H18N4O3/c14-13(15)16-8-4-7-10(12(19)20)17-11(18)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,17,18)(H,19,20)(H4,14,15,16)/t10-/m0/s1 |
| InChIKey | RSYYQCDERUOEFI-JTQLQIEISA-N |
| SMILES | C(O)(=O)[C@H](CCCNC(N)=N)NC(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 154-92-7(CAS DataBase Reference) |
Description and Uses
N-α-Benzoyl-L-arginine can be used as as growth inhibitors in microbial antitumor screen.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-22-36-26 |
| HazardClass | IRRITANT |






