A6188212
4-Nitro-L-phenylalanine monohydrate , 98% , 207591-86-4
CAS NO.：207591-86-4
Empirical Formula: C9H12N2O5
Molecular Weight: 228.2
MDL number: MFCD00150543
EINECS: 681-542-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100g | RMB215.20 | In Stock |
|
| 500g | RMB979.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-251 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | Off-White |
| optical activity | [α]25/D +6.8°, c = 1.3 in 3 M HCl |
| BRN | 2809673 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H10N2O4.H2O/c10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15;/h1-4,8H,5,10H2,(H,12,13);1H2/t8-;/m0./s1 |
| InChIKey | OLZDHJRNUIXKLU-QRPNPIFTSA-N |
| SMILES | O.N[C@@H](Cc1ccc(cc1)[N+]([O-])=O)C(O)=O |
| CAS DataBase Reference | 207591-86-4(CAS DataBase Reference) |
Description and Uses
4-Nitro-L-phenylalanine monohydrate is used in the synthesis of Zolmitriptan.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | AY7400000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
