A6188412
4-Nitro-DL-phenylalanine , 98% , 2922-40-9
CAS NO.：2922-40-9
Empirical Formula: C9H10N2O4
Molecular Weight: 210.19
MDL number: MFCD00007384
EINECS: 220-868-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB231.20 | In Stock |
|
| 100g | RMB761.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-237 °C (dec.) (lit.) |
| Boiling point: | 414.1±35.0 °C(Predicted) |
| Density | 1.408±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.12±0.10(Predicted) |
| color | Off-white to brown |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChI | 1S/C9H10N2O4/c10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15/h1-4,8H,5,10H2,(H,12,13) |
| InChIKey | GTVVZTAFGPQSPC-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(cc1)[N+]([O-])=O)C(O)=O |
| CAS DataBase Reference | 2922-40-9(CAS DataBase Reference) |
Description and Uses
4-Nitro-DL-phenylalanine may be used as an internal standard for the determination of β-N-methylamino-L-alanine (L-BMAA) in environmental aqueous samples using proton nuclear magnetic resonance (1H NMR) technique.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,C,F |
| Risk Statements | 25-34-11 |
| Safety Statements | 45-36/37/39-26-16 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
