A6194812
N-Methyl-1-naphthylmethylamine , 98% , 14489-75-9
CAS NO.：14489-75-9
Empirical Formula: C12H13N
Molecular Weight: 171.24
MDL number: MFCD00144934
EINECS: 238-497-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB16.00 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB132.80 | In Stock |
|
| 500G | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189.5-190 °C |
| Boiling point: | 104 °C |
| Density | 1,05 g/cm3 |
| refractive index | 1.6160-1.6190 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | clear liquid |
| pka | 9.38±0.10(Predicted) |
| color | Colorless to Orange to Green |
| PH | 10.71 at 24℃ and 10g/L |
| InChI | InChI=1S/C12H13N/c1-13-9-11-7-4-6-10-5-2-3-8-12(10)11/h2-8,13H,9H2,1H3 |
| InChIKey | MQRIUFVBEVFILS-UHFFFAOYSA-N |
| SMILES | C1(CNC)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference | 14489-75-9(CAS DataBase Reference) |
Description and Uses
Terbinafine EP Impurity A. Terbinafine BP Impurity A. Terbinafine USP Related Compound A
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2921.49.5000 |
| HazardClass | IRRITANT |
