A6195212
5-Nitro-1,10-phenanthroline , 98% , 4199-88-6
Synonym(s):
Nitroferroin
CAS NO.:4199-88-6
Empirical Formula: C12H7N3O2
Molecular Weight: 225.2
MDL number: MFCD00004981
EINECS: 224-097-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB110.40 | In Stock |
|
| 5G | RMB370.40 | In Stock |
|
| 25G | RMB1413.60 | In Stock |
|
| 100G | RMB4671.20 | In Stock |
|
| 50g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-204 °C(lit.) |
| Boiling point: | 366.71°C (rough estimate) |
| Density | 1.2844 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Alcohol,Benzene |
| form | crystalline |
| pka | pK1:3.232(+1) (25°C) |
| color | yellow to orange |
| biological source | synthetic |
| Water Solubility | insoluble |
| BRN | 196245 |
| InChI | InChI=1S/C12H7N3O2/c16-15(17)10-7-8-3-1-5-13-11(8)12-9(10)4-2-6-14-12/h1-7H |
| InChIKey | PDDBTWXLNJNICS-UHFFFAOYSA-N |
| SMILES | N1C2C(=C([N+]([O-])=O)C=C3C=2N=CC=C3)C=CC=1 |
| CAS DataBase Reference | 4199-88-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,10-Phenanthroline, 5-nitro- (4199-88-6) |
Description and Uses
5-Nitro-1,10-phenanthroline complexes of iron find wide applications in redox titrations. It is used as a precursor for the synthesis of 5-amino-1,10-phenanthroline, 5-isothiocyanato-1,10-phenanthroline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






