A6196612
4-Nitrobenzotrifluoride , 98% , 402-54-0
Synonym(s):
4-Nitro-α,α,α-trifluorotoluene
CAS NO.:402-54-0
Empirical Formula: C7H4F3NO2
Molecular Weight: 191.11
MDL number: MFCD00007358
EINECS: 206-948-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB175.20 | In Stock |
|
| 5G | RMB447.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40 °C (lit.) |
| Boiling point: | 81-83 °C/10 mmHg (lit.) |
| Density | 1.3910 (estimate) |
| Flash point: | 191 °F |
| solubility | soluble in Methanol |
| form | Crystalline Powder, Crystals or Crystalline Mass |
| color | White to yellow |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents, strong reducing agents. |
| InChI | 1S/C7H4F3NO2/c8-7(9,10)5-1-3-6(4-2-5)11(12)13/h1-4H |
| InChIKey | XKYLCLMYQDFGKO-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 402-54-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitro-alpha,alpha,alpha-trifluorotoluene(402-54-0) |
| EPA Substance Registry System | Benzene, 1-nitro-4-(trifluoromethyl)- (402-54-0) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H330-H335 |
| Precautionary statements | P260-P264-P301+P312-P302+P352-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,T,Xi |
| Risk Statements | 22-26-36/37/38-21/22 |
| Safety Statements | 26-28-36/37-45-36/37/39-28A |
| RIDADR | UN 3431 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |






