A6197612
2-Nitro-1,4-phenylenediamine , 95% , 5307-14-2
Synonym(s):
1,4-Diamino-2-nitrobenzene;2-Nitro-p-phenylenediamine
CAS NO.:5307-14-2
Empirical Formula: C6H7N3O2
Molecular Weight: 153.14
MDL number: MFCD00007903
EINECS: 226-164-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB30.40 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB172.00 | In Stock |
|
| 500G | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-138 °C (lit.) |
| Boiling point: | 276.04°C (rough estimate) |
| Density | 1.3682 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 0.2g/l |
| pka | 4.36±0.10(Predicted) |
| form | Powder |
| color | Brown to black |
| PH | 7 (H2O)(aqueous suspension) |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| BRN | 2210195 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 1,4-Diamino-2-nitrobenzene (5307-14-2) |
| InChI | 1S/C6H7N3O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,7-8H2 |
| InChIKey | HVHNMNGARPCGGD-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N)c(c1)[N+]([O-])=O |
| LogP | 0.53 |
| CAS DataBase Reference | 5307-14-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Benzenediamine, 2-nitro-(5307-14-2) |
| IARC | 3 (Vol. Sup 7, 57) 1993 |
| EPA Substance Registry System | 2-Nitro-p-phenylenediamine (5307-14-2) |
Description and Uses
o-Nitro-paraphenylenediamine (ONPD) is a hair dye and a sensitizer in hairdressers.
This compound is used in hair and fur dyes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 43-68 |
| Safety Statements | 36/37-45 |
| RIDADR | 3143 |
| WGK Germany | 2 |
| RTECS | ST3000000 |
| TSCA | TSCA listed |
| HS Code | 29215119 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
| Hazardous Substances Data | 5307-14-2(Hazardous Substances Data) |




![2-(((4-Methoxy-3-methylpyridin-2-yl)methyl)thio)-6-(1H-pyrrol-1-yl)-1H-benzo[d]imidazole](https://img.chemicalbook.com/CAS/20180703/GIF/172152-35-1.gif)

