A7916312
2,3,5,6-Tetramethyl-1,4-phenylenediamine , >98.0%(GC)(T) , 3102-87-2
Synonym(s):
3,6-Diaminodurene
CAS NO.：3102-87-2
Empirical Formula: C10H16N2
Molecular Weight: 164.25
MDL number: MFCD00007905
EINECS: 221-457-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB76.00 | In Stock |
|
| 5G | RMB258.40 | In Stock |
|
| 25G | RMB924.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-155 °C(lit.) |
| Boiling point: | 281.73°C (rough estimate) |
| Density | 1.0244 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 6.11±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2208743 |
| InChI | InChI=1S/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 |
| InChIKey | WCZNKVPCIFMXEQ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C(C)=C(N)C(C)=C1C |
| CAS DataBase Reference | 3102-87-2(CAS DataBase Reference) |
Description and Uses
2,3,5,6-Tetramethyl-1,4-phenylenediaminev is used in the preparation of polyimide coatings for electronic applications-IC passivation, dielectric for multichip modules, and as a stress relief layer in sensor applications.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-22 |
| WGK Germany | 3 |
| RTECS | CZ1599700 |
| HS Code | 29215190 |
