A6197712
2-Chloro-5-nitrotoluene , 99% , 13290-74-9
CAS NO.:13290-74-9
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00041430
EINECS: 236-306-8
| Pack Size | Price | Stock | Quantity |
| 10g | RMB44.80 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB221.60 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-44 °C |
| Boiling point: | 94-96°C 4mm |
| Density | 1.3246 (rough estimate) |
| refractive index | 1.5377 (estimate) |
| Flash point: | 94-96°C/4mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Yellow to Green |
| BRN | 2044766 |
| InChI | 1S/C7H6ClNO2/c1-5-4-6(9(10)11)2-3-7(5)8/h2-4H,1H3 |
| InChIKey | BGDCQZFFNFXYQC-UHFFFAOYSA-N |
| SMILES | Cc1cc(ccc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 13290-74-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloro-5-nitrotoluene (13290-74-9) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS07,GHS06,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H312-H331-H373-H401-H411-H302+H312+H332-H315-H319-H412 |
| Precautionary statements | P261-P264-P270-P271-P273-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P260-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-52/53 |
| Safety Statements | 22-36/37-61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2902900000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral |







