A6199712
3-Nitrobenzenesulfonamide , 98% , 121-52-8
CAS NO.：121-52-8
Empirical Formula: C6H6N2O4S
Molecular Weight: 202.19
MDL number: MFCD00007935
EINECS: 204-477-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB146.40 | In Stock |
|
| 100G | RMB511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-168 °C (lit.) |
| Boiling point: | 407.7±47.0 °C(Predicted) |
| Density | 1.505 (estimate) |
| refractive index | 1.6490 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9.47±0.60(Predicted) |
| form | Powder |
| color | White to off-white |
| Water Solubility | 444.8mg/L(15 ºC) |
| InChI | 1S/C6H6N2O4S/c7-13(11,12)6-3-1-2-5(4-6)8(9)10/h1-4H,(H2,7,11,12) |
| InChIKey | TXTQURPQLVHJRE-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cccc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 121-52-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonamide, 3-nitro- (121-52-8) |
Description and Uses
3-Nitrobenzenesulfonamide may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
