A6199812
4-Nitrobenzenesulfonamide , 98% , 6325-93-5
CAS NO.:6325-93-5
Empirical Formula: C6H6N2O4S
Molecular Weight: 202.19
MDL number: MFCD00007937
EINECS: 228-691-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 10g | RMB68.80 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-180 °C (lit.) |
| Boiling point: | 417.8±47.0 °C(Predicted) |
| Density | 1.505 (estimate) |
| refractive index | 1.6490 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9.48±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light yellow to beige |
| Water Solubility | 606.6mg/L(15 ºC) |
| InChI | InChI=1S/C6H6N2O4S/c7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-4H,(H2,7,11,12) |
| InChIKey | QWKKYJLAUWFPDB-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 6325-93-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonamide, 4-nitro- (6325-93-5) |
Description and Uses
4-Nitrobenzenesulfonamide is the nitrene source during on pot procedure for copper(I)-catalyzed asymmetric alkene aziridination. It reacts with diazacrown ether, N,N′-dibenzyl-1,7,10,16-tetraoxo-4,13-diazacyclooctadecane to form molecular complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-22 |
| WGK Germany | 3 |
| RTECS | DB2975000 |
| TSCA | TSCA listed |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




