A6200512
trans-β-Nitrostyrene , 98% , 5153-67-3
Synonym(s):
trans-1-Nitro-2-phenylethylene;trans-beta-Nitrostyrene
CAS NO.:5153-67-3
Empirical Formula: C8H7NO2
Molecular Weight: 149.15
MDL number: MFCD00007402
EINECS: 629-597-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB76.00 | In Stock |
|
| 25G | RMB232.80 | In Stock |
|
| 100G | RMB801.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-58 °C(lit.) |
| Boiling point: | 250-260 °C(lit.) |
| Density | 1.2517 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| Flash point: | 250-260°C |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Crystals |
| color | Yellow |
| Water Solubility | Insoluble in water. |
| λmax | 320nm(lit.) |
| BRN | 1210066 |
| InChI | 1S/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+ |
| InChIKey | PIAOLBVUVDXHHL-VOTSOKGWSA-N |
| SMILES | [O-][N+](=O)\C=C\c1ccccc1 |
| NIST Chemistry Reference | Styrene, «beta»-nitro-, (E)-(5153-67-3) |
Description and Uses
trans-β-Nitrostyrene, and its derivatives such as 3,4-methylenedioxy-β-nitrostyrene (MNS) and 4-O-benzoyl-3-methoxy-β-nitrostyrene (BMNS), has shown to exhibit potent anti-platelet activities and cytotoxicity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | WL5460000 |
| TSCA | Yes |
| HS Code | 29042090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







