A6201212
5-Nitrovanillin , 98% , 6635-20-7
Synonym(s):
4-Hydroxy-3-methoxy-5-nitrobenzaldehyde
CAS NO.:6635-20-7
Empirical Formula: C8H7NO5
Molecular Weight: 197.14
MDL number: MFCD00007118
EINECS: 229-633-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB186.40 | In Stock |
|
| 500g | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-175 °C (lit.) |
| Boiling point: | 334.23°C (rough estimate) |
| Density | 1.5023 (rough estimate) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.5700 (estimate) |
| Flash point: | 97℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 2.1g/L in organic solvents at 20 ℃ |
| form | powder to crystal |
| pka | 4.97±0.38(Predicted) |
| color | Yellow to Brown to Dark green |
| Water Solubility | 700mg/L at 23℃ |
| Sensitive | Air Sensitive |
| BRN | 1973746 |
| InChI | 1S/C8H7NO5/c1-14-7-3-5(4-10)2-6(8(7)11)9(12)13/h2-4,11H,1H3 |
| InChIKey | ZEHYRTJBFMZHCY-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc(OC)c(O)c(c1)[N+]([O-])=O |
| LogP | 0.301 at 23℃ |
| CAS DataBase Reference | 6635-20-7(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Nitrovanillin (6635-20-7) |
Description and Uses
5-Nitrovanillin is a reagent used in the synthesis of feruloyl and caffeoyl which have antitumor properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |






