A6202112
Nitrobenzene-d<sub>5</sub> , D,99% , 4165-60-0
Synonym(s):
Pentadeuteronitrobenzene
CAS NO.:4165-60-0
Empirical Formula: C6D5NO2
Molecular Weight: 128.14
MDL number: MFCD00044415
EINECS: 224-014-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB358.40 | In Stock |
|
| 25G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6°C |
| Boiling point: | 88 °C12 mm Hg(lit.) |
| Density | 1.253 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | 2-8°C |
| solubility | 1.9g/l |
| form | Liquid |
| color | Clear colorless to yellow |
| PH | 8.1 (1g/l, H2O, 20℃) |
| explosive limit | 1.8-40%(V) |
| BRN | 1455693 |
| Stability: | Stable. Hygroscopic. Combustible. Incompatible with strong oxidizing agents, strong reducing agents, strong bases. |
| InChI | 1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | LQNUZADURLCDLV-RALIUCGRSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])[N+]([O-])=O |
| CAS DataBase Reference | 4165-60-0(CAS DataBase Reference) |
| EPA Substance Registry System | Nitrobenzene-d5 (4165-60-0) |
| CAS Number Unlabeled | 98-95-3 |
Description and Uses
(Nitrobenzene-d5) Labelled Nitrobenzene, used mainly in the production of the chemical precursor aniline.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H351-H360F-H372-H412 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P304+P340+P311 |
| target organs | Blood |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N,Xn |
| Risk Statements | 23/24/25-40-48/23/24-51/53-62-63-43-36/37/38-45-52/53-48/23/24/25-60-67 |
| Safety Statements | 28-36/37-45-61-24/25-23-53-26 |
| RIDADR | UN 1662 6.1/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 Carc. 2 Repr. 1B STOT RE 1 Inhalation |







