A6202712
Nysted Reagent , 20wt.%suspensioninTHF , 41114-59-4
Synonym(s):
cyclo-Dibromodi-μ-methylene[μ-(tetrahydrofuran)]trizinc
CAS NO.:41114-59-4
Empirical Formula: C6H12Br2OZn3
Molecular Weight: 456.14
MDL number: MFCD00134567
| Pack Size | Price | Stock | Quantity |
| 25G | RMB93.60 | In Stock |
|
| 100G | RMB303.20 | In Stock |
|
| 500G | RMB1022.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.186 g/mL at 25 °C(lit.) |
| Flash point: | −15 °F |
| form | slurry |
| InChI | InChI=1S/C4H8O.2CH.2BrH.3Zn/c1-2-4-5-3-1;;;;;;;/h1-4H2;4*1H;;;/q;2*-1;;;;2*+2/p-2 |
| InChIKey | CCTHTLJWXPUNGT-UHFFFAOYSA-L |
| SMILES | [Br-][Zn+2]1[CH-][Zn][CH-][Zn+2]([Br-])O21CCCC2 |
| CAS DataBase Reference | 41114-59-4 |
Description and Uses
Nysted Reagent is a reagent used in synthetic reactions such as the synthesis of Entcavir.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H319-H335-H336-H351 |
| Precautionary statements | P201-P202-P210-P233-P305+P351+P338-P308+P313 |
| target organs | Central nervous system, Respiratory system |
| Hazard Codes | F,Xn |
| Risk Statements | 11-14-19-22-36/37/38-40-36/37 |
| Safety Statements | 16-26-36-36/37 |
| RIDADR | UN 3399 4.3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |






