A6203512
5-Nitroisophthalic Acid Dimethyl Ester , 98% , 13290-96-5
Synonym(s):
Dimethyl 5-nitrobenzene-1,3-dicarboxylate
CAS NO.:13290-96-5
Empirical Formula: C10H9NO6
Molecular Weight: 239.18
MDL number: MFCD00008429
EINECS: 236-307-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB30.40 | In Stock |
|
| 50G | RMB55.20 | In Stock |
|
| 100G | RMB121.60 | In Stock |
|
| 250G | RMB191.20 | In Stock |
|
| 500g | RMB340.00 | In Stock |
|
| 1KG | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-125 °C (lit.) |
| Boiling point: | 381.83°C (rough estimate) |
| Density | 1.4504 (rough estimate) |
| refractive index | 1.5310 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2140916 |
| InChI | InChI=1S/C10H9NO6/c1-16-9(12)6-3-7(10(13)17-2)5-8(4-6)11(14)15/h3-5H,1-2H3 |
| InChIKey | GGTSJKFPGKFLCZ-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=CC([N+]([O-])=O)=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 13290-96-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Benzenedicarboxylic acid, 5-nitro-, dimethyl ester(13290-96-5) |
| EPA Substance Registry System | Dimethyl 5-nitroisophthalate (13290-96-5) |
Description and Uses
Dimethyl 5-nitroisophthalate has been used as starting reagent in the synthesis of 5-nitro-1,3-bis(ethylenediamine) and 5-nitroisophthaldihydrazide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-24/25-36 |
| RIDADR | UN 2811 |
| WGK Germany | 2 |
| RTECS | CZ4340000 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |




