A6212612
Nefiracetam , ≥98% , 77191-36-7
Synonym(s):
(2-(2-Oxopyrrolidin-1-yl)-N-(2,6-dimethylphenyl)-acetamide);DM-9384
CAS NO.:77191-36-7
Empirical Formula: C14H18N2O2
Molecular Weight: 246.3
MDL number: MFCD00209882
EINECS: 636-080-4
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB278.40 | In Stock |
|
| 1G | RMB391.20 | In Stock |
|
| 200mg | RMB556.00 | In Stock |
|
| 250MG | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-155°C |
| Boiling point: | 458.5±33.0 °C(Predicted) |
| Density | 1.187±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: >5mg/mL |
| pka | 13.77±0.70(Predicted) |
| form | solid |
| color | white to off-white |
| Merck | 14,6439 |
| InChI | InChI=1S/C14H18N2O2/c1-10-5-3-6-11(2)14(10)15-12(17)9-16-8-4-7-13(16)18/h3,5-6H,4,7-9H2,1-2H3,(H,15,17) |
| InChIKey | NGHTXZCKLWZPGK-UHFFFAOYSA-N |
| SMILES | N1(CC(NC2=C(C)C=CC=C2C)=O)CCCC1=O |
| CAS DataBase Reference | 77191-36-7(CAS DataBase Reference) |
Description and Uses
analgesic, antiinflammatory
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | UX9655650 |
| HS Code | 2933.79.1500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in mice (mg/kg): 421 i.v.; 1766 orally (Betzing, 1982) |





