A6229012
Naphthofluorescein , ≥95%(HPLC) , 61419-02-1
CAS NO.：61419-02-1
Empirical Formula: C28H16O5
Molecular Weight: 432.42
MDL number: MFCD00329026
EINECS: 634-716-5
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB308.80 | In Stock |
|
| 500MG | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189 °C (dec.)(lit.) |
| Boiling point: | 755.5±60.0 °C(Predicted) |
| Density | 1.58±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMF: soluble |
| form | A crystalline solid |
| pka | 8.82±0.20(Predicted) |
| color | Purple to purplish red |
| BRN | 61335 |
| InChI | 1S/C28H16O5/c29-17-7-9-19-15(13-17)5-11-23-25(19)32-26-20-10-8-18(30)14-16(20)6-12-24(26)28(23)22-4-2-1-3-21(22)27(31)33-28/h1-14,29-30H |
| InChIKey | IXQIUDNVFVTQLJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c3Oc4c(ccc5cc(O)ccc45)C6(OC(=O)c7ccccc67)c3ccc2c1 |
| EPA Substance Registry System | Spiro[7H-dibenzo[c,h]xanthene-7,1'(3'H)-isobenzofuran]-3'-one, 3,11-dihydroxy- (61419-02-1) |
Description and Uses
Naphthofluorescein is a furin inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10 |
| TSCA | TSCA listed |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
