A6230012
Naphthol AS-BI phosphate , 93% , 1919-91-1
Synonym(s):
7-Bromo-3-hydroxy-2-naphthoic-o-anisidide phosphate;Naphthol AS-BI Phosphoric acid solution
CAS NO.:1919-91-1
Empirical Formula: C18H15BrNO6P
Molecular Weight: 452.19
MDL number: MFCD00004058
EINECS: 217-645-0
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB231.20 | In Stock |
|
| 500MG | RMB799.20 | In Stock |
|
| 1G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.679±0.06 g/cm3(Predicted) |
| Flash point: | 37 °C |
| storage temp. | 2-8°C |
| solubility | methanol: soluble50mg/mL |
| form | Crystalline Powder |
| pka | 0.73±0.30(Predicted) |
| color | Light yellow |
| Appearance | Solid Powder |
| BRN | 6668526 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C18H15BrNO6P/c1-25-16-5-3-2-4-15(16)20-18(21)14-9-12-8-13(19)7-6-11(12)10-17(14)26-27(22,23)24/h2-10H,1H3,(H,20,21)(H2,22,23,24) |
| InChIKey | HUXIAXQSTATULQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC(Br)=C2)=CC(OP(O)(O)=O)=C1C(NC1=CC=CC=C1OC)=O |
| CAS DataBase Reference | 1919-91-1 |
| EPA Substance Registry System | 2-Naphthalenecarboxamide, 7-bromo-N-(2-methoxyphenyl)-3-(phosphonooxy)- (1919-91-1) |
Description and Uses
Naphthol AS-BI-phosphate is a fluorogenic substrate for acid and alkaline phosphatases. Naphthol AS-BI-phosphate is cleaved to release the fluorescent moiety naphthol AS-BI (N-ASBI), which can be used to quantify the activity of acid and alkaline phosphatases. Acid and alkaline phosphatases are commonly used for diagnosis of diseases.
Naphthol AS-BI phosphate is suitable to use:
- in tartrate-resistant acid phosphatase (TRAP) staining to detect osteoclast activity
- as a component in Tris-HCl in staining cells to measure alkaline phosphatase (ALP) activity
- to perform alkaline phosphatase reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | T,Xi,C,F |
| Risk Statements | 61-20/21-36/37/38-39/23/24/25-20/21/22-10-34-11-36 |
| Safety Statements | 7-16-36/37-45-36-26-36/37/39-23-53 |
| RIDADR | UN 2265 3/PG 3 |
| WGK Germany | 3 |
| F | 8-10-21 |
| TSCA | TSCA listed |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |






