PRODUCT Properties
| Melting point: | 102-104 °C |
| Boiling point: | 157.3±23.0 °C(Predicted) |
| Density | 1.095 (estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Sparingly, Sonicated), Methanol (Slightly) |
| pka | 15.35±0.40(Predicted) |
| color | White to Beige |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C4H8N2S/c1-3-2-5-4(7)6-3/h3H,2H2,1H3,(H2,5,6,7) |
| InChIKey | NGZJXCFNBVJLQN-UHFFFAOYSA-N |
| SMILES | C1(=S)NCC(C)N1 |
| EPA Substance Registry System | 2-Imidazolidinethione, 4-methyl- (2122-19-2) |
Description and Uses
N,N''-(1,2-Propylene)thiourea is an intermediate used in various organic chemical reactions such as the preparation of aryl 2-Iminoimidazoline derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H361d-H412 |
| Precautionary statements | P201-P202-P264-P273-P301+P312-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 22-52/53-63 |
| Safety Statements | 36/37-46-61 |
| WGK Germany | 3 |
| RTECS | NJ0400000 |
| HS Code | 2933299090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Repr. 2 |








