A6233312
N-(p-Toluenesulfonyl)urea , ≥98.0%(HPLC) , 1694-06-0
CAS NO.:1694-06-0
Empirical Formula: C8H10N2O3S
Molecular Weight: 214.24
MDL number: MFCD00196522
EINECS: 216-900-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 100g | RMB68.00 | In Stock |
|
| 500g | RMB239.20 | In Stock |
|
| 2.5kg | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196-198 °C |
| Density | 1.3844 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 5.07±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 777.9mg/L(37 ºC) |
| InChI | InChI=1S/C8H10N2O3S/c1-6-2-4-7(5-3-6)14(12,13)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| InChIKey | RUTYWCZSEBLPAK-UHFFFAOYSA-N |
| SMILES | C1(S(NC(N)=O)(=O)=O)=CC=C(C)C=C1 |
| CAS DataBase Reference | 1694-06-0(CAS DataBase Reference) |
Description and Uses
4-Methylphenylsulfonylurea can be used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H304-H225 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P331-P303+P361+P353-P301+P310-P403+P235-P405 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 45-36/37/39-26 |
| WGK Germany | WGK 3 |
| HS Code | 2935.90.9500 |
| Storage Class | 11 - Combustible Solids |







