A6234312
N-Methyl Paroxetine , 99% , 110429-36-2
Synonym(s):
(3S-trans)-3-[(1,3-Benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)-1-methylpiperidine;N-Methylparoxetine
CAS NO.：110429-36-2
Empirical Formula: C20H22FNO3
Molecular Weight: 343.39
MDL number: MFCD03788781
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB159.20 | In Stock |
|
| 1g | RMB319.20 | In Stock |
|
| 5g | RMB1039.20 | In Stock |
|
| 10MG | RMB1535.20 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109.0 to 113.0 °C |
| Boiling point: | 443.7±45.0 °C(Predicted) |
| Density | 1.198±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 8.48±0.20(Predicted) |
| color | Off-White to Pale Yellow |
| BRN | 7468178 |
| InChI | InChI=1S/C20H22FNO3/c1-22-9-8-18(14-2-4-16(21)5-3-14)15(11-22)12-23-17-6-7-19-20(10-17)25-13-24-19/h2-7,10,15,18H,8-9,11-13H2,1H3/t15-,18-/m0/s1 |
| InChIKey | MOJZPKOBKCXNKG-YJBOKZPZSA-N |
| SMILES | N1(C)CC[C@@H](C2=CC=C(F)C=C2)[C@H](COC2=CC=C3OCOC3=C2)C1 |
| CAS DataBase Reference | 110429-36-2(CAS DataBase Reference) |
Description and Uses
A drug impurity of Paroxetin, a selective serotonin reuptake inhibitor. Paroxetine USP Related Compound F.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H410 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| Hazard Codes | T,N |
| Risk Statements | 25-50/53 |
| Safety Statements | 45-60-61 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933.39.9200 |
