A6234412
4-N-Boc-2-methylpiperazine , 97% , 120737-59-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB244.80 | In Stock |
|
| 100g | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 268.7±15.0 °C(Predicted) |
| Density | 0.997±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform, DMSO, Ethyl Acetate |
| form | Oil |
| pka | 8.52±0.40(Predicted) |
| color | Clear Colourless |
| InChI | InChI=1S/C10H20N2O2/c1-8-7-12(6-5-11-8)9(13)14-10(2,3)4/h8,11H,5-7H2,1-4H3 |
| InChIKey | FMLPQHJYUZTHQS-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCNC(C)C1 |
| CAS DataBase Reference | 120737-59-9(CAS DataBase Reference) |
Description and Uses
4-N-Boc-2-methylpiperazine is a boc protetcted piperazine derivative used in the preparation of prazosin-related compounds with blocking activity toward α-adrenoreceptors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 26-36/37/39-61-37 |
| RIDADR | UN3077 |
| HS Code | 29335990 |




