A6234612
1,5-Naphthyridine , ≥97.0% , 254-79-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB23.20 | In Stock |
|
| 250MG | RMB35.20 | In Stock |
|
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-75 °C |
| Boiling point: | 152 °C / 54mmHg |
| Density | 1.25 |
| refractive index | 1.6231 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.90±0.10(Predicted) |
| form | Solid |
| color | Off-white |
| InChI | InChI=1S/C8H6N2/c1-3-7-8(9-5-1)4-2-6-10-7/h1-6H |
| InChIKey | VMLKTERJLVWEJJ-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC=CC=2)C=CC=1 |
| CAS DataBase Reference | 254-79-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,5-Naphthyridine(254-79-5) |
Description and Uses
1,5-Naphthyridine is one of the six possible isomers of diazanaphthalenes containing one nitrogen atom in each ring without any at a bridgehead position, exhibiting a pKa of 2.91[6]. Fused 1,5-naphthyridines serve as structural components in fused porphyrin dimers or biological sensors for Cu2+ ions[7]. Metal complexes of 1,5-naphthyridine with platinum or europium function as emissive dyes in light-emitting diodes and exciton-blocking layers in solar cells[8].
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







