A6236412
4-Nitrophenyl Trifluoroacetate , ≥98.0%(GC) , 658-78-6
CAS NO.：658-78-6
Empirical Formula: C8H4F3NO4
Molecular Weight: 235.12
MDL number: MFCD00007324
EINECS: 211-524-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.80 | In Stock |
|
| 5G | RMB92.80 | In Stock |
|
| 25G | RMB366.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-39 °C (lit.) |
| Boiling point: | 120 °C/12 mmHg (lit.) |
| Density | 1.5675 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| BRN | 658785 |
| InChI | InChI=1S/C8H4F3NO4/c9-8(10,11)7(13)16-6-3-1-5(2-4-6)12(14)15/h1-4H |
| InChIKey | JFOIBTLTZWOAIC-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)C(F)(F)F |
| CAS DataBase Reference | 658-78-6(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, trifluoro-, 4-nitrophenyl ester (658-78-6) |
Description and Uses
4-Nitrophenyl Trifluoroacetate is used as a reagent for the preparation of 4-nitrophenyl active esters from acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 21 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
