A6236512
4-(Boc-amino)benzoic acid , >98.0%(HPLC) , 66493-39-8
Synonym(s):
4-(Boc-amino)benzoic acid
CAS NO.:66493-39-8
Empirical Formula: C12H15NO4
Molecular Weight: 237.25
MDL number: MFCD00037428
EINECS: 676-774-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5g | RMB78.40 | In Stock |
|
| 25g | RMB201.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~200 °C (dec.) |
| Boiling point: | 336.2±25.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Methanol |
| pka | 4.33±0.10(Predicted) |
| form | Powder |
| color | Beige |
| BRN | 2115614 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H15NO4/c1-12(2,3)17-11(16)13-9-6-4-8(5-7-9)10(14)15/h4-7H,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | ZJDBQMWMDZEONW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(cc1)C(O)=O |
Description and Uses
4-(N-tert-Butoxycarbonyl)aminobenzoic Acid is the tert-Butyloxycarbonyl group protected derivative of 4-Aminobenzoic Acid (A591500), an widely distributed B complex factor in nature.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






![4-[(tert-butoxycarbonyl)amino]-2-hydroxybenzoicacid](https://img.chemicalbook.com/CAS/GIF/184033-42-9.gif)