PRODUCT Properties
| Melting point: | 195°C |
| Boiling point: | 509.6±35.0 °C(Predicted) |
| Density | 1.840±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 1.41±0.35(Predicted) |
| form | solid |
| color | Cream |
| InChI | InChI=1S/C4H3N3O4/c8-4(9)3-2(7(10)11)1-5-6-3/h1H,(H,5,6)(H,8,9) |
| InChIKey | ZMAXXOYJWZZQBK-UHFFFAOYSA-N |
| SMILES | N1C=C([N+]([O-])=O)C(C(O)=O)=N1 |
| CAS DataBase Reference | 5334-40-7(CAS DataBase Reference) |
Description and Uses
4-Nitro-3-pyrazolecarboxylic acid may be used as a starting reagent for the synthesis of library of pyrazole derivatives, potential A3 adenosine receptor (A3AR) antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-36/37/39-37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
