A6238412
Boc-D-Nva-OH , ≥98.0% , 57521-85-4
Synonym(s):
(R)-2-(Boc-amino)pentanoic acid;Boc-D -norvaline
| Pack Size | Price | Stock | Quantity |
| 5G | RMB719.20 | In Stock |
|
| 25G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 348.3±25.0 °C(Predicted) |
| Density | 1.081±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.02±0.20(Predicted) |
| form | Powder |
| color | White |
| BRN | 5260625 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m1/s1 |
| InChIKey | INWOAUUPYIXDHN-SSDOTTSWSA-N |
| SMILES | CCC[C@@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 57521-85-4(CAS DataBase Reference) |
Description and Uses
BOC-D-NVA-OH is a chemical reagent used in the preparation of benzothiophene inhibitors of MK2. Also has been used to synthesize pyrrolidine diketopiperazines to inhibit melanoma
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 12 - Non Combustible Liquids |
