A1284112
Boc-D-Arg(Tos)-OH , 98% , 61315-61-5
Synonym(s):
Boc-D-Arg(Tos)-OH;N-α-t.-Boc-N G-tosyl-D-arginine;Nα-Boc-Nω-tosyl-D -arginine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB136.80 | In Stock |
|
| 5G | RMB317.60 | In Stock |
|
| 25G | RMB1149.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-100°C |
| alpha | -5 º (c=1,EtOH) |
| Density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | -15°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder |
| pka | 3.95±0.21(Predicted) |
| BRN | 4726241 |
| Major Application | peptide synthesis |
| InChIKey | WBIIPXYJAMICNU-CQSZACIVSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)NC(=N)NCCC[C@@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 61315-61-5(CAS DataBase Reference) |
Description and Uses
Boc-D-Arg(Tos)-OH, is an Arginine derivative, used in various chemical synthesis, and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |







