A6231612
N(alpha)-boc-L-arginine , 98% , 13726-76-6
Synonym(s):
Nα-(tert-Butoxycarbonyl)-L -arginine;Nα-Boc-L -arginine
CAS NO.：13726-76-6
Empirical Formula: C11H22N4O4
Molecular Weight: 274.32
MDL number: MFCD00042632
EINECS: 237-295-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB194.40 | In Stock |
|
| 10g | RMB291.20 | In Stock |
|
| 25G | RMB758.40 | In Stock |
|
| 100g | RMB1503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C |
| Density | 1.28±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMF: 15mg/mL,DMSO: 15mg/mL,Ethanol: 15mg/mL,PBS (pH 7.2): 10mg/mL |
| form | A solid |
| pka | 3.92±0.21(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 6.5°, c = 1 in acetic acid |
| BRN | 2419628 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H22N4O4/c1-11(2,3)19-10(18)15-7(8(16)17)5-4-6-14-9(12)13/h7H,4-6H2,1-3H3,(H,15,18)(H,16,17)(H4,12,13,14)/t7-/m0/s1 |
| InChIKey | HSQIYOPBCOPMSS-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(N)=N)C(O)=O |
| CAS DataBase Reference | 13726-76-6(CAS DataBase Reference) |
Description and Uses
Boc-Arg-OH is a nucleic acid carrier and a peptide that functions in the delivery systems of genes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P403-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
