BD3966546
(R)-tert-Butyl(1-oxo-3-phenylpropan-2-yl)carbamate , 95% , 77119-85-8
Synonym(s):
(R)-(+)-2-(tert-Butoxycarbonylamino)-3-phenylpropanal
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB179.20 | In Stock |
|
| 1g | RMB386.40 | In Stock |
|
| 5g | RMB1631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C (lit.) |
| storage temp. | -20°C |
| form | Crystalline Powder |
| color | White or tan |
| optical activity | [α]20/D +45°, c = 0.5 in methanol |
| Major Application | peptide synthesis |
| InChI | 1S/C14H19NO3/c1-14(2,3)18-13(17)15-12(10-16)9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | ZJTYRNPLVNMVPQ-GFCCVEGCSA-N |
| SMILES | [H]C(=O)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
Description and Uses
Boc-D-phenylalaninal is a useful research chemical compound used as a reactant in the copper(I)-catalyzed synthesis of 1,2,3-triazoles as inhibitors of human immunodeficiency virus type 1 protease.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29223900 |
| Storage Class | 13 - Non Combustible Solids |
