A1202512
Boc-L-prolinal , 97% , 69610-41-9
Synonym(s):
(S)-N-Boc-pyrrolidine-2-carboxaldehyde;N-(tert-Butoxycarbonyl)-L -prolinal
CAS NO.:69610-41-9
Empirical Formula: C10H17NO3
Molecular Weight: 199.25
MDL number: MFCD00274186
EINECS: 627-548-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB73.60 | In Stock |
|
| 5G | RMB271.20 | In Stock |
|
| 25g | RMB1125.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -101 º (c=0.66 in chloroform) |
| Boiling point: | 211 °C (lit.) |
| Density | 1.063 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 135 °F |
| storage temp. | -20°C |
| pka | -3.03±0.40(Predicted) |
| form | liquid |
| color | Light brown |
| Specific Gravity | 1.063 |
| optical activity | [α]20/D 101°, c = 0.66 in chloroform |
| Water Solubility | Slightly soluble water. Soluble in chloroform. |
| Sensitive | Air Sensitive |
| Major Application | peptide synthesis |
| InChI | 1S/C10H17NO3/c1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h7-8H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | YDBPZCVWPFMBDH-QMMMGPOBSA-N |
| SMILES | [H]C(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| CAS DataBase Reference | 69610-41-9(CAS DataBase Reference) |
Description and Uses
Key building block for norsecurinine-type alkaloids and isaindigotidione carboskeleton.1,2
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1989 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








