A6476625
                    <I>N>-(<I>tert>-Butoxycarbonyl)-<SC>DC>-prolinal , 97% , 73365-02-3
CAS NO.:73365-02-3
Empirical Formula: C10H17NO3
Molecular Weight: 199.25
MDL number: MFCD01321389
EINECS: 624-637-4
| Pack Size | Price | Stock | Quantity | 
| 250mg | RMB39.20 | In Stock | 
                                                 | 
                                        
| 1g | RMB79.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB253.60 | In Stock | 
                                                 | 
                                        
| 25g | RMB1039.20 | In Stock | 
                                                 | 
                                        
| 100g | RMB3599.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| alpha | +83°(23℃, neat) | 
                                    
| Boiling point: | 228 °C(lit.) | 
                                    
| Density | 1.059 g/mL at 25 °C(lit.) | 
                                    
| refractive index | n | 
                                    
| Flash point: | >230 °F | 
                                    
| storage temp. | -20°C | 
                                    
| pka | -3.03±0.40(Predicted) | 
                                    
| form | Liquid | 
                                    
| Specific Gravity | 1.059 | 
                                    
| color | Colorless to yellow | 
                                    
| optical activity | [α]23/D +83°, neat | 
                                    
| Sensitive | Air Sensitive | 
                                    
| InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h7-8H,4-6H2,1-3H3/t8-/m1/s1 | 
                                    
| InChIKey | YDBPZCVWPFMBDH-MRVPVSSYSA-N | 
                                    
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H]1C=O | 
                                    
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 3 | 
| HS Code | 29339980 | 







