A6238712
2-Naphthylacetonitrile , ≥98.0%(GC) , 7498-57-9
Synonym(s):
2-Naphthaleneacetonitrile
CAS NO.:7498-57-9
Empirical Formula: C12H9N
Molecular Weight: 167.21
MDL number: MFCD00004122
EINECS: 231-352-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB119.20 | In Stock |
|
| 25G | RMB322.40 | In Stock |
|
| 100g | RMB1224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84 °C (lit.) |
| Boiling point: | 303 °C (lit.) |
| Density | 1.092 g/mL at 25 °C (lit.) |
| refractive index | 1.5785 (estimate) |
| Flash point: | 303°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 1862879 |
| InChI | InChI=1S/C12H9N/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9H,7H2 |
| InChIKey | LPCWDVLDJVZIHA-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CC#N |
| CAS DataBase Reference | 7498-57-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthylacetonitrile(7498-57-9) |
Description and Uses
2-Naphthylacetonitrile was used as starting reagent in the synthesis of 2-(1-cyano-1-(2-naphthyl))methylidene-3-phenyl-thiazolidine-4,5-dione.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,C,F |
| Risk Statements | 20/21/22-34-11 |
| Safety Statements | 36-24/25-45-36/37/39-26-16 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






