A6241612
2-Amino-3-nitro-6-(4-fluorobenzylamino)pyridine , 97% , 33400-49-6
CAS NO.:33400-49-6
Empirical Formula: C12H11FN4O2
Molecular Weight: 262.24
MDL number: MFCD08282317
EINECS: 251-498-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB37.60 | In Stock |
|
| 1G | RMB84.00 | In Stock |
|
| 5G | RMB234.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-180°C |
| Boiling point: | 464.5±45.0 °C(Predicted) |
| Density | 1.447±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.52±0.50(Predicted) |
| color | Yellow |
| InChI | 1S/C12H11FN4O2/c13-9-3-1-8(2-4-9)7-15-11-6-5-10(17(18)19)12(14)16-11/h1-6H,7H2,(H3,14,15,16) |
| InChIKey | ZVCIIRBNNSUNCH-UHFFFAOYSA-N |
| SMILES | NC1=NC(NCC2=CC=C(F)C=C2)=CC=C1[N+]([O-])=O |
Description and Uses
Intermediate in the preparation of Flupirtine metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






