A6241712
N-Benzyloxycarbonyl-L-aspartic acid 1-benzyl ester , 95% , 4779-31-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB108.00 | In Stock |
|
| 25G | RMB384.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-85°C |
| Boiling point: | 583.5±50.0 °C(Predicted) |
| Density | 1.293±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetone, Chloroform, DMSO, Ether, Methanol |
| form | Solid |
| pka | 4.09±0.19(Predicted) |
| color | Colourless to White |
| InChI | InChI=1S/C19H19NO6/c21-17(22)11-16(18(23)25-12-14-7-3-1-4-8-14)20-19(24)26-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,20,24)(H,21,22)/t16-/m0/s1 |
| InChIKey | UYOZWZKJQRBZRH-INIZCTEOSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)[C@H](CC(O)=O)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 4779-31-1(CAS DataBase Reference) |
Description and Uses
N-Carbobenzyloxy-L-aspartic Acid 1-Benzyl Ester (cas# 4779-31-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
