A6242812
2-Norbornanemethanol , 97%, internal type and appearance mixture , 5240-72-2
CAS NO.:5240-72-2
Empirical Formula: C8H14O
Molecular Weight: 126.2
MDL number: MFCD00074722
EINECS: 226-041-6
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB455.20 | In Stock |
|
| 100ML | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 93-95 °C14 mm Hg(lit.) |
| Density | 0.942 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 184 °F |
| storage temp. | Store at room temperature |
| pka | 15.05±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| Water Solubility | 999mg/L(temperature not stated) |
| InChI | InChI=1S/C8H14O/c9-5-8-4-6-1-2-7(8)3-6/h6-9H,1-5H2 |
| InChIKey | LWHKUVOYICRGGR-UHFFFAOYSA-N |
| SMILES | C12CC(CC1)CC2CO |
| CAS DataBase Reference | 5240-72-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Bicyclo[2.2.1]heptane-2-methanol(5240-72-2) |
| EPA Substance Registry System | Bicyclo[2.2.1]heptane-2-methanol (5240-72-2) |
Description and Uses
2-Norbornanemethanol undergoes condensation reaction with methacryloyl chloride to yield bicyclo[2.2.1]hept-2-ylmethyl 2-methylacrylate comonomer for synthesis of fluorinated poly(maleimide-co-glycidylmethacrylate).
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H302+H332-H311-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RB7350000 |
| TSCA | TSCA listed |
| HS Code | 2906.19.5000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orl-rat: 1600 mg/kg 28ZEAL 4,302,69 |




