A6243312
5-(4-Nitrophenyl)furfural , ≥98.0%(HPLC) , 7147-77-5
Synonym(s):
(5-(4-nitrophenyl)-2-furancarboxyaldehyde;5-(4-Nitrophenyl)-2-furancarboxaldehyde;5-(4-Nitrophenyl)furfural
CAS NO.:7147-77-5
Empirical Formula: C11H7NO4
Molecular Weight: 217.18
MDL number: MFCD00124191
EINECS: 230-459-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100g | RMB463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C(lit.) |
| Boiling point: | 406.8±35.0 °C(Predicted) |
| Density | 1.348±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Ethyl Acetate (Slightly, Heated) |
| form | Solid |
| color | Yellow to Dark Yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C11H7NO4/c13-7-10-5-6-11(16-10)8-1-3-9(4-2-8)12(14)15/h1-7H |
| InChIKey | RTSOJVJDKNKNFU-UHFFFAOYSA-N |
| SMILES | O1C(C2=CC=C([N+]([O-])=O)C=C2)=CC=C1C=O |
| CAS DataBase Reference | 7147-77-5(CAS DataBase Reference) |
Description and Uses
A furfural nitrophenyl derivative as antibacterial and fungistatic agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P301+P312+P330 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |




