A6244212
3-Nitrobenzylamine hydrochloride , 97% , 26177-43-5
CAS NO.:26177-43-5
Empirical Formula: C7H8N2O2.ClH
Molecular Weight: 188.61
MDL number: MFCD00012858
EINECS: 247-502-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB87.20 | In Stock |
|
| 5G | RMB463.20 | In Stock |
|
| 25G | RMB899.20 | In Stock |
|
| 100G | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-231 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| color | Off-white to tan |
| InChI | 1S/C7H8N2O2.ClH/c8-5-6-2-1-3-7(4-6)9(10)11;/h1-4H,5,8H2;1H |
| InChIKey | DLZXLCHQWOZGSE-UHFFFAOYSA-N |
| SMILES | Cl.NCc1cccc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 26177-43-5(CAS DataBase Reference) |
Description and Uses
3-Nitrobenzylamine Hydrochloride is an intermediate in many organic syntheses.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-33-23/24 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







