A6245012
4-Nitrophthalic anhydride , tech.90% , 5466-84-2
CAS NO.:5466-84-2
Empirical Formula: C8H3NO5
Molecular Weight: 193.11
MDL number: MFCD00005922
EINECS: 226-776-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB99.20 | In Stock |
|
| 100g | RMB381.60 | In Stock |
|
| 500g | RMB1581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-120 °C(lit.) |
| Boiling point: | 197 °C / 8mmHg |
| Density | 1.6392 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Beige |
| Water Solubility | Hydrolysis |
| Sensitive | Moisture Sensitive |
| BRN | 179682 |
| InChI | InChI=1S/C8H3NO5/c10-7-5-2-1-4(9(12)13)3-6(5)8(11)14-7/h1-3H |
| InChIKey | MMVIDXVHQANYAE-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C([N+]([O-])=O)C=C2)C(=O)O1 |
| CAS DataBase Reference | 5466-84-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitrophthalic anhydride(5466-84-2) |
| EPA Substance Registry System | 5-Nitrophthalic anhydride (5466-84-2) |
Description and Uses
4-Nitrophthalic anhydride is used an an intermediate for the synthesis of a benzimidazole PARP inhibitor I (succinate salt) (ABT-472).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| RTECS | TI3328000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







