A6245412
4-Nitro-<small>L</small>-phenylalanine Methyl Ester Hydrochloride , ≥98.0%(HPLC) , 17193-40-7
Synonym(s):
p-Nitrophenylalanine methyl ester hydrochloride;Methyl 4-nitro-L -phenylalaninate hydrochloride
CAS NO.：17193-40-7
Empirical Formula: C10H13ClN2O4
Molecular Weight: 260.67
MDL number: MFCD00135754
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.80 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 10g | RMB103.20 | In Stock |
|
| 25G | RMB200.00 | In Stock |
|
| 100g | RMB620.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-214 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| color | White to Light yellow |
| optical activity | 20.9° (c=1.0 g/100ml, ETOH) |
| BRN | 5176380 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H12N2O4.ClH/c1-16-10(13)9(11)6-7-2-4-8(5-3-7)12(14)15;/h2-5,9H,6,11H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | BTHMRXRBXYHLRA-FVGYRXGTSA-N |
| SMILES | Cl[H].COC(=O)[C@@H](N)Cc1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 17193-40-7(CAS DataBase Reference) |
Description and Uses
4-Nitro-L-Phenylalanine Methyl Ester Hydrochloride, is an intermediate in the synthesis of various pharmaceutical compounds. It can be used for the preparation of Matijing-Su derivatives as potent anti-HBV agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P261-P280a-P305+P351+P338-P321-P333+P313-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22-43-36 |
| Safety Statements | 22-36/37-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
