A6247212
Nortriptyline Hydrochloride , ≥98%(HPLC) , 894-71-3
Synonym(s):
3-(10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-1-propanamine hydrochloride;Desmethylamitriptyline hydrochloride;Nortriptyline hydrochloride
CAS NO.:894-71-3
Empirical Formula: C19H22ClN
Molecular Weight: 299.84
MDL number: MFCD00058024
EINECS: 212-973-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB144.00 | In Stock |
|
| 5G | RMB349.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-220?C |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | ethanol: 100 mg/mL |
| form | powder |
| color | white to off-white |
| λmax | 237nm(H2O)(lit.) |
| Merck | 14,6715 |
| InChI | InChI=1S/C19H21N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-11,20H,6,12-14H2,1H3;1H |
| InChIKey | SHAYBENGXDALFF-UHFFFAOYSA-N |
| SMILES | C1(=C/CCNC)\C2C=CC=CC=2CCC2C=CC=CC\1=2.Cl |
Description and Uses
Nortriptyline Hydrochloride (Amitriptyline EP Impurity C) is a tricyclic antidepressant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-36/38-23/25-11-39/23/24/25-23/24/25 |
| Safety Statements | 22-36-45-24-16-7-36/37 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| RTECS | HP0175000 |
| HS Code | 2921490002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 oral in rat: 405mg/kg |





