A6250012
N-Boc-1,2-phenyldiamine , 95% , 146651-75-4
Synonym(s):
(2-Aminophenyl)-carbamic acid tert-butyl ester;Mono-N-Boc-o-phenylenediamine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-114 °C |
| Boiling point: | 280.6±23.0 °C(Predicted) |
| Density | 1.152±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.47±0.70(Predicted) |
| color | Light Yellow |
| InChI | InChI=1S/C11H16N2O2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8(9)12/h4-7H,12H2,1-3H3,(H,13,14) |
| InChIKey | KCZFBLNQOSFGSH-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1=CC=CC=C1N |
Description and Uses
Protected 1,2-Phenyldiamine, an intermediate in the synthesis of histone deacetylase agents and antitumor agents.






