A6254612
5-Nitroindoline , ≥97% , 32692-19-6
CAS NO.：32692-19-6
Empirical Formula: C8H8N2O2
Molecular Weight: 164.16
MDL number: MFCD00005709
EINECS: 251-158-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB317.60 | In Stock |
|
| 100G | RMB1159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94 °C(lit.) |
| Boiling point: | 324.4±31.0 °C(Predicted) |
| Density | 1.298±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 0.86±0.20(Predicted) |
| form | powder |
| color | Brown |
| InChI | 1S/C8H8N2O2/c11-10(12)7-1-2-8-6(5-7)3-4-9-8/h1-2,5,9H,3-4H2 |
| InChIKey | WJQWYAJTPPYORB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2NCCc2c1 |
| CAS DataBase Reference | 32692-19-6(CAS DataBase Reference) |
Description and Uses
5-Nitroindoline was used to prepare acetylated glucosylamines using the Suvorov procedure.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | NM1930000 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
