A6255112
5-Nitro-2-thiophenecarboxaldehyde , ≥98% , 4521-33-9
CAS NO.：4521-33-9
Empirical Formula: C5H3NO3S
Molecular Weight: 157.15
MDL number: MFCD00005433
EINECS: 224-850-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB156.80 | In Stock |
|
| 100G | RMB574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77 °C (lit.) |
| Boiling point: | 118-120 °C(Press: 3-4 Torr) |
| Density | 1.534±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | acetone: soluble1%, clear, yellow |
| form | Solid |
| color | Brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 120540 |
| InChI | InChI=1S/C5H3NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
| InChIKey | CHTSWZNXEKOLPM-UHFFFAOYSA-N |
| SMILES | C1(C=O)SC([N+]([O-])=O)=CC=1 |
| CAS DataBase Reference | 4521-33-9(CAS DataBase Reference) |
Description and Uses
5-Nitrothiophene-2-carboxaldehyde is a reagent that is used in the activity of mefloquine-oxazolidine derivatives against multidrug-resistant Mycobacterium tuberculosis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29349990 |
