A6263512
<i>N</i>-Methylmaleimide , >98.0%(GC) , 930-88-1
CAS NO.：930-88-1
Empirical Formula: C5H5NO2
Molecular Weight: 111.1
MDL number: MFCD00005508
EINECS: 213-226-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB81.60 | In Stock |
|
| 25G | RMB302.40 | In Stock |
|
| 100G | RMB988.00 | In Stock |
|
| 500g | RMB4776.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| Boiling point: | 208.19°C (rough estimate) |
| Density | 1.3113 (rough estimate) |
| refractive index | 1.4260 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Crystals |
| pka | -2.18±0.20(Predicted) |
| color | Light yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 108550 |
| InChI | InChI=1S/C5H5NO2/c1-6-4(7)2-3-5(6)8/h2-3H,1H3 |
| InChIKey | SEEYREPSKCQBBF-UHFFFAOYSA-N |
| SMILES | N1(C)C(=O)C=CC1=O |
| CAS DataBase Reference | 930-88-1(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Methylmaleimide(930-88-1) |
Description and Uses
N-Methylmaleimide is an electron deficient olefin that acts as a thiol-blocking reagent.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H317 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 22-34-43-25-20/21 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| RTECS | ON5600000 |
| F | 10-21 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29241990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
