A6264212
2-Norbornanone , >98.0%(GC) , 497-38-1
CAS NO.:497-38-1
Empirical Formula: C7H10O
Molecular Weight: 110.15
MDL number: MFCD00074823
EINECS: 207-846-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1g | RMB72.00 | In Stock |
|
| 5G | RMB200.80 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-96 °C(lit.) |
| Boiling point: | 168-172 °C(lit.) |
| Density | 0.9023 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| Flash point: | 93 °F |
| storage temp. | Flammables area |
| form | Adhering Crystals |
| color | Colorless to white |
| Water Solubility | Insoluble in water. Soluble in methanol. |
| BRN | 1209657 |
| InChI | InChI=1S/C7H10O/c8-7-4-5-1-2-6(7)3-5/h5-6H,1-4H2 |
| InChIKey | KPMKEVXVVHNIEY-UHFFFAOYSA-N |
| SMILES | C12CC(CC1)CC2=O |
| LogP | 0.892 (est) |
| CAS DataBase Reference | 497-38-1(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]heptan-2-one (497-38-1) |
Description and Uses
Norcamphor is used as a building block in organic synthesis. It is also used as a precursor to norborneols.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H228 |
| Precautionary statements | P210 |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| RTECS | RB7680000 |
| TSCA | Yes |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29142900 |
| Toxicity | LD50 ivn-mus: 180 mg/kg CSLNX* NX#04039 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





![Bicyclo[3.2.1]octan-3-one](https://img.chemicalbook.com/CAS/GIF/14252-05-2.gif)

