A6267612
Nonafluoro-<i>tert</i>-butyl Alcohol , 95% , 2378-02-1
Synonym(s):
1,1,1,3,3,3-Hexafluoro-2-trifluoromethyl-2-propanol;Perfluoro-tert-butyl alcohol
CAS NO.:2378-02-1
Empirical Formula: C4HF9O
Molecular Weight: 236.04
MDL number: MFCD00042092
EINECS: 219-157-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB191.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25G | RMB2129.60 | In Stock |
|
| 100g | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -17°C |
| Boiling point: | 45 °C (lit.) |
| Density | 1.693 g/mL at 25 °C (lit.) |
| vapor pressure | 5.19 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 44-45°C |
| storage temp. | Keep Cold |
| form | Liquid |
| pka | 7.05±0.53(Predicted) |
| color | Clear colorless |
| Specific Gravity | 1.693 |
| BRN | 1841640 |
| InChI | 1S/C4HF9O/c5-2(6,7)1(14,3(8,9)10)4(11,12)13/h14H |
| InChIKey | XZNOAVNRSFURIR-UHFFFAOYSA-N |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 2378-02-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanol, 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)- (2378-02-1) |
Description and Uses
Nonafluoro-tert-butyl Alcohol is used in production of SO2-based electrolytes for rechargeable battery cells with improved stability, improved performance, low production cost.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H315-H319-H331-H335 |
| Precautionary statements | P261-P264-P271-P302+P352-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 20-36/37/38-23 |
| Safety Statements | 26-45-36/37 |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | UB6452700 |
| Hazard Note | Toxic |
| HazardClass | KEEP COLD, TOXIC |
| HazardClass | 6.1 |
| HS Code | 29062990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LC50,inhalation,10230mg/m3/2H (10230mg/m3),"Prehled Prumyslove Toxikologie; Organicke Latky," Marhold, J., Prague, Czechoslovakia, Avicenum, 1986Vol. -, Pg. 521, 1986. |




