A6269912
3-Nitrobenzoyl Chloride , >98.0%(GC) , 121-90-4
CAS NO.:121-90-4
Empirical Formula: C7H4ClNO3
Molecular Weight: 185.56
MDL number: MFCD00007247
EINECS: 204-505-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-34 °C(lit.) |
| Boiling point: | 275-278 °C(lit.) |
| Density | 1.42 |
| refractive index | 1.5810 (estimate) |
| Flash point: | >230 °F |
| solubility | soluble in Ether,Benzene,Toluene |
| form | Low Melting Solid |
| color | Brown |
| Specific Gravity | 1.59 |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 777186 |
| InChI | 1S/C7H4ClNO3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H |
| InChIKey | NXTNASSYJUXJDV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(c1)C(Cl)=O |
| CAS DataBase Reference | 121-90-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 3-nitro-(121-90-4) |
| EPA Substance Registry System | m-Nitrobenzoyl chloride (121-90-4) |
Description and Uses
3-Nitrobenzoyl Chloride is an useful building block reagent in the preparation of organic compounds of research interest.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H312-H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 5-21-34-37 |
| Safety Statements | 26-36/37/39-45-7/9-38 |
| RIDADR | UN 2923 8/PG 3 |
| WGK Germany | 3 |
| RTECS | DM6646000 |
| F | 9-19-21 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Dam. 1 Skin Corr. 1B |





