A6272512
<i>N</i>-Ethyl-<i>p</i>-toluidine , >98.0% , 622-57-1
CAS NO.：622-57-1
Empirical Formula: C9H13N
Molecular Weight: 135.21
MDL number: MFCD00035793
EINECS: 210-742-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -6.87°C (estimate) |
| Boiling point: | 222 °C |
| Density | 0,94 g/cm3 |
| refractive index | 1.5430-1.5450 |
| Flash point: | 93°C |
| solubility | soluble in Alcohol,Ether |
| form | clear liquid |
| pka | 5.67±0.32(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H13N/c1-3-10-9-6-4-8(2)5-7-9/h4-7,10H,3H2,1-2H3 |
| InChIKey | AASABFUMCBTXRL-UHFFFAOYSA-N |
| SMILES | C1(NCC)=CC=C(C)C=C1 |
| CAS DataBase Reference | 622-57-1(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Ethyl-p-toluidine(622-57-1) |
| EPA Substance Registry System | Benzenamine, N-ethyl-4-methyl- (622-57-1) |
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H227-H300+H310+H330-H315-H319-H412 |
| Precautionary statements | P210-P260-P262-P264-P270-P271-P273-P280-P284-P301+P310+P330-P302+P352+P310+P361+P364-P304+P340+P310-P305+P351+P338+P337+P313-P370+P378-P403+P233-P405-P501 |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-36/37/39 |
| RIDADR | 2754 |
| HS Code | 2921.43.9090 |
| HazardClass | 6.1 |
| PackingGroup | II |
